C12H14O2 — CID 130128997
3,3-dimethyl-2,7b-dihydro-1aH-naphtho[1,2-b]oxiren-2-ol (PubChem CID 130128997) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3,3-dimethyl-2,7b-dihydro-1aH-naphtho[1,2-b]oxiren-2-ol.
| Compound Name | 3,3-dimethyl-2,7b-dihydro-1aH-naphtho[1,2-b]oxiren-2-ol |
|---|---|
| PubChem CID | 130128997 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3,3-dimethyl-2,7b-dihydro-1aH-naphtho[1,2-b]oxiren-2-ol |
| SMILES | CC1(C)c2ccccc2C2OC2C1O |
| InChI | InChI=1S/C12H14O2/c1-12(2)8-6-4-3-5-7(8)9-10(14-9)11(12)13/h3-6,9-11,13H,1-2H3 |
| InChIKey | ZMLZPIZLQMYTRC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|