C18H24 — CID 172640775
1,1,2,3,4,4-hexamethyl-3a,8b-dihydrocyclopenta[a]indene (PubChem CID 172640775) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,1,2,3,4,4-hexamethyl-3a,8b-dihydrocyclopenta[a]indene.
| Compound Name | 1,1,2,3,4,4-hexamethyl-3a,8b-dihydrocyclopenta[a]indene |
|---|---|
| PubChem CID | 172640775 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1,1,2,3,4,4-hexamethyl-3a,8b-dihydrocyclopenta[a]indene |
| SMILES | CC1=C(C)C(C)(C)C2c3ccccc3C(C)(C)C12 |
| InChI | InChI=1S/C18H24/c1-11-12(2)17(3,4)16-13-9-7-8-10-14(13)18(5,6)15(11)16/h7-10,15-16H,1-6H3 |
| InChIKey | CQFRBUDXBYHSMV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|