C19H22O2 — CID 170673933
(1S,2R,3S,4R)-1,4-dimethyl-4-(2-methylphenyl)-2,3-dihydro-1H-naphthalene-2,3-diol (PubChem CID 170673933) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1S,2R,3S,4R)-1,4-dimethyl-4-(2-methylphenyl)-2,3-dihydro-1H-naphthalene-2,3-diol.
| Compound Name | (1S,2R,3S,4R)-1,4-dimethyl-4-(2-methylphenyl)-2,3-dihydro-1H-naphthalene-2,3-diol |
|---|---|
| PubChem CID | 170673933 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (1S,2R,3S,4R)-1,4-dimethyl-4-(2-methylphenyl)-2,3-dihydro-1H-naphthalene-2,3-diol |
| SMILES | Cc1ccccc1[C@]1(C)c2ccccc2[C@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22O2/c1-12-8-4-6-10-15(12)19(3)16-11-7-5-9-14(16)13(2)17(20)18(19)21/h4-11,13,17-18,20-21H,1-3H3/t13-,17+,18+,19+/m0/s1 |
| InChIKey | VNEUHFACVHNCHI-JGNHQEBTSA-N |
| XLogP | 3.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |