C15H22 — CID 177097652
(2R)-1,1,2,4,4-pentamethyl-2,3-dihydronaphthalene (PubChem CID 177097652) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (2R)-1,1,2,4,4-pentamethyl-2,3-dihydronaphthalene.
| Compound Name | (2R)-1,1,2,4,4-pentamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 177097652 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (2R)-1,1,2,4,4-pentamethyl-2,3-dihydronaphthalene |
| SMILES | C[C@@H]1CC(C)(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C15H22/c1-11-10-14(2,3)12-8-6-7-9-13(12)15(11,4)5/h6-9,11H,10H2,1-5H3/t11-/m1/s1 |
| InChIKey | VLKFGNVVNLUROM-LLVKDONJSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |