C14H16O — CID 134905673
CID 134905673 (PubChem CID 134905673) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol.
| Compound Name | CID 134905673 |
|---|---|
| PubChem CID | 134905673 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | — |
| SMILES | CC1CC12c1ccccc1C1(CC1)[C@@H]2O |
| InChI | InChI=1S/C14H16O/c1-9-8-14(9)11-5-3-2-4-10(11)13(6-7-13)12(14)15/h2-5,9,12,15H,6-8H2,1H3/t9?,12-,14?/m0/s1 |
| InChIKey | QBPYALCESZYQPR-PEUVISTOSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |