C14H20O — CID 7103216
(2S)-1,1,4,4-tetramethyl-2,3-dihydronaphthalen-2-ol (PubChem CID 7103216) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (2S)-1,1,4,4-tetramethyl-2,3-dihydronaphthalen-2-ol.
| Compound Name | (2S)-1,1,4,4-tetramethyl-2,3-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 7103216 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2S)-1,1,4,4-tetramethyl-2,3-dihydronaphthalen-2-ol |
| SMILES | CC1(C)C[C@H](O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H20O/c1-13(2)9-12(15)14(3,4)11-8-6-5-7-10(11)13/h5-8,12,15H,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | MUQUOWCASLCEEY-LBPRGKRZSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |