About 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene
5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene (PubChem CID 125494585) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene.
Analyze 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene?
The IUPAC name of 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene (CID 125494585) is 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene.
What is the SMILES notation for 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene?
The canonical SMILES for 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene is CC1(C)CCCC(C)(C)c2ccccc21.
What is the InChIKey of 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene?
The InChIKey is OCZYFBURSCIPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-14(2)10-7-11-15(3,4)13-9-6-5-8-12(13)14/h5-6,8-9H,7,10-11H2,1-4H3.
What are the key properties of 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene?
5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene has a molecular weight of 202.34 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5,9,9-tetramethyl-7,8-dihydro-6H-benzo[7]annulene is sourced from PubChem (CID 125494585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).