C11H14OS — CID 118181619
4,4-dimethyl-2,3-dihydrothiochromene 1-oxide (PubChem CID 118181619) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 4,4-dimethyl-2,3-dihydrothiochromene 1-oxide.
| Compound Name | 4,4-dimethyl-2,3-dihydrothiochromene 1-oxide |
|---|---|
| PubChem CID | 118181619 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 4,4-dimethyl-2,3-dihydrothiochromene 1-oxide |
| SMILES | CC1(C)CCS(=O)c2ccccc21 |
| InChI | InChI=1S/C11H14OS/c1-11(2)7-8-13(12)10-6-4-3-5-9(10)11/h3-6H,7-8H2,1-2H3 |
| InChIKey | FGUACECGBKRWQQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |