C9H11ClOS — CID 175204383
3,4-dihydro-2H-thiochromene 1-oxide;hydrochloride (PubChem CID 175204383) has the molecular formula C9H11ClOS and a molecular weight of 202.71 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromene 1-oxide;hydrochloride.
| Compound Name | 3,4-dihydro-2H-thiochromene 1-oxide;hydrochloride |
|---|---|
| PubChem CID | 175204383 |
| Molecular Formula | C9H11ClOS |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 3,4-dihydro-2H-thiochromene 1-oxide;hydrochloride |
| SMILES | Cl.O=S1CCCc2ccccc21 |
| InChI | InChI=1S/C9H10OS.ClH/c10-11-7-3-5-8-4-1-2-6-9(8)11;/h1-2,4,6H,3,5,7H2;1H |
| InChIKey | MCWDMQDCHOALOY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |