About (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol
(2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol (PubChem CID 129403969) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol.
Molecular Properties
| Compound Name | (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol |
| PubChem CID | 129403969 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol |
| SMILES | CC1(C)C[C@H](O)Oc2ccccc21 |
| InChI | InChI=1S/C11H14O2/c1-11(2)7-10(12)13-9-6-4-3-5-8(9)11/h3-6,10,12H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | DEMCRDLQVFJMMP-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol?
The IUPAC name of (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol (CID 129403969) is (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol.
What is the SMILES notation for (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol?
The canonical SMILES for (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol is CC1(C)C[C@H](O)Oc2ccccc21.
What is the InChIKey of (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol?
The InChIKey is DEMCRDLQVFJMMP-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H14O2/c1-11(2)7-10(12)13-9-6-4-3-5-8(9)11/h3-6,10,12H,7H2,1-2H3/t10-/m1/s1.
What are the key properties of (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol?
(2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol has a molecular weight of 178.23 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-dimethyl-2,3-dihydrochromen-2-ol is sourced from PubChem (CID 129403969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).