About 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one
7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one (PubChem CID 86181568) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one.
Analyze 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one?
The IUPAC name of 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one (CID 86181568) is 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one.
What is the SMILES notation for 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one?
The canonical SMILES for 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one is CC12CC(=O)C1Oc1ccccc12.
What is the InChIKey of 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one?
The InChIKey is KJLKIPVZJGMCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c1-11-6-8(12)10(11)13-9-5-3-2-4-7(9)11/h2-5,10H,6H2,1H3.
What are the key properties of 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one?
7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one has a molecular weight of 174.20 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7b-methyl-1,2a-dihydrocyclobuta[b][1]benzofuran-2-one is sourced from PubChem (CID 86181568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).