C9H8O2 — CID 54113383
6b-methyl-1aH-oxireno[2,3-b][1]benzofuran (PubChem CID 54113383) has the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. Its IUPAC name is 6b-methyl-1aH-oxireno[2,3-b][1]benzofuran.
| Compound Name | 6b-methyl-1aH-oxireno[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 54113383 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 6b-methyl-1aH-oxireno[2,3-b][1]benzofuran |
| SMILES | CC12OC1Oc1ccccc12 |
| InChI | InChI=1S/C9H8O2/c1-9-6-4-2-3-5-7(6)10-8(9)11-9/h2-5,8H,1H3 |
| InChIKey | NIQPVOLBZPSYTK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|