C16H14O2 — CID 11118112
(1S,9S)-1-methyl-8,16-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene (PubChem CID 11118112) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is (1S,9S)-1-methyl-8,16-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene.
| Compound Name | (1S,9S)-1-methyl-8,16-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 11118112 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1S,9S)-1-methyl-8,16-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
| SMILES | C[C@]12C[C@H](Oc3ccccc31)c1ccccc1O2 |
| InChI | InChI=1S/C16H14O2/c1-16-10-15(11-6-2-4-8-13(11)18-16)17-14-9-5-3-7-12(14)16/h2-9,15H,10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | STNCPZLMPFHILD-HOTGVXAUSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |