C12H12O4 — CID 135042959
methyl spiro[2,3-dihydrochromene-4,2'-oxirane]-2-carboxylate (PubChem CID 135042959) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is methyl spiro[2,3-dihydrochromene-4,2'-oxirane]-2-carboxylate.
| Compound Name | methyl spiro[2,3-dihydrochromene-4,2'-oxirane]-2-carboxylate |
|---|---|
| PubChem CID | 135042959 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | methyl spiro[2,3-dihydrochromene-4,2'-oxirane]-2-carboxylate |
| SMILES | COC(=O)C1CC2(CO2)c2ccccc2O1 |
| InChI | InChI=1S/C12H12O4/c1-14-11(13)10-6-12(7-15-12)8-4-2-3-5-9(8)16-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | RFLKVRYWVGLRGA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|