C20H21N3O5 — CID 71193436
methyl 1'-(4-nitro-2-pyridinyl)spiro[2,3-dihydrochromene-4,4'-piperidine]-2-carboxylate (PubChem CID 71193436) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is methyl 1'-(4-nitro-2-pyridinyl)spiro[2,3-dihydrochromene-4,4'-piperidine]-2-carboxylate.
| Compound Name | methyl 1'-(4-nitro-2-pyridinyl)spiro[2,3-dihydrochromene-4,4'-piperidine]-2-carboxylate |
|---|---|
| PubChem CID | 71193436 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 1'-(4-nitro-2-pyridinyl)spiro[2,3-dihydrochromene-4,4'-piperidine]-2-carboxylate |
| SMILES | COC(=O)C1CC2(CCN(c3cc([N+](=O)[O-])ccn3)CC2)c2ccccc2O1 |
| InChI | InChI=1S/C20H21N3O5/c1-27-19(24)17-13-20(15-4-2-3-5-16(15)28-17)7-10-22(11-8-20)18-12-14(23(25)26)6-9-21-18/h2-6,9,12,17H,7-8,10-11,13H2,1H3 |
| InChIKey | FVHWEQJTTXBWIX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|