C19H18N4O2 — CID 71193691
(1S)-1'-(4-nitro-2-pyridinyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-carbonitrile (PubChem CID 71193691) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (1S)-1'-(4-nitro-2-pyridinyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-carbonitrile.
| Compound Name | (1S)-1'-(4-nitro-2-pyridinyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-carbonitrile |
|---|---|
| PubChem CID | 71193691 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1S)-1'-(4-nitro-2-pyridinyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-carbonitrile |
| SMILES | N#C[C@H]1CC2(CCN(c3cc([N+](=O)[O-])ccn3)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H18N4O2/c20-13-14-12-19(17-4-2-1-3-16(14)17)6-9-22(10-7-19)18-11-15(23(24)25)5-8-21-18/h1-5,8,11,14H,6-7,9-10,12H2/t14-/m1/s1 |
| InChIKey | KOOHOMDOEQCKJA-CQSZACIVSA-N |
| XLogP | 3.54 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|