C18H19N3O3 — CID 71193686
5-methyl-1'-(4-nitro-2-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 71193686) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-methyl-1'-(4-nitro-2-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 5-methyl-1'-(4-nitro-2-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 71193686 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-methyl-1'-(4-nitro-2-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)C1(CCN(c3cc([N+](=O)[O-])ccn3)CC1)OC2 |
| InChI | InChI=1S/C18H19N3O3/c1-13-2-3-14-12-24-18(16(14)10-13)5-8-20(9-6-18)17-11-15(21(22)23)4-7-19-17/h2-4,7,10-11H,5-6,8-9,12H2,1H3 |
| InChIKey | LZAQPERDKCSCFS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|