C17H20N4O2 — CID 3713602
1-(2,4-dimethylphenyl)-4-(5-nitro-2-pyridinyl)piperazine (PubChem CID 3713602) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-(5-nitro-2-pyridinyl)piperazine.
| Compound Name | 1-(2,4-dimethylphenyl)-4-(5-nitro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 3713602 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-(5-nitro-2-pyridinyl)piperazine |
| SMILES | Cc1ccc(N2CCN(c3ccc([N+](=O)[O-])cn3)CC2)c(C)c1 |
| InChI | InChI=1S/C17H20N4O2/c1-13-3-5-16(14(2)11-13)19-7-9-20(10-8-19)17-6-4-15(12-18-17)21(22)23/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | HVXOAYNYVSNXGU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|