C22H27N5O5S — CID 59706463
(5-methylsulfonyl-2-piperidin-1-ylphenyl)-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 59706463) has the molecular formula C22H27N5O5S and a molecular weight of 473.56 g/mol. Its IUPAC name is (5-methylsulfonyl-2-piperidin-1-ylphenyl)-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (5-methylsulfonyl-2-piperidin-1-ylphenyl)-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59706463 |
| Molecular Formula | C22H27N5O5S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (5-methylsulfonyl-2-piperidin-1-ylphenyl)-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)N2CCN(c3ccc([N+](=O)[O-])cn3)CC2)c1 |
| InChI | InChI=1S/C22H27N5O5S/c1-33(31,32)18-6-7-20(24-9-3-2-4-10-24)19(15-18)22(28)26-13-11-25(12-14-26)21-8-5-17(16-23-21)27(29)30/h5-8,15-16H,2-4,9-14H2,1H3 |
| InChIKey | VGUPMSMWKNLQFG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|