C23H25FN4O3S — CID 59793707
3-fluoro-4-[4-(5-methylsulfonyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]benzonitrile (PubChem CID 59793707) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-fluoro-4-[4-(5-methylsulfonyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[4-(5-methylsulfonyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 59793707 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-fluoro-4-[4-(5-methylsulfonyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]benzonitrile |
| SMILES | CS(=O)(=O)c1ccc(N2CCCC2)c(C(=O)N2CCN(c3ccc(C#N)cc3F)CC2)c1 |
| InChI | InChI=1S/C23H25FN4O3S/c1-32(30,31)18-5-7-21(26-8-2-3-9-26)19(15-18)23(29)28-12-10-27(11-13-28)22-6-4-17(16-25)14-20(22)24/h4-7,14-15H,2-3,8-13H2,1H3 |
| InChIKey | FAULPXIUWWHELN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |