C25H30FIN4O3S — CID 143289185
[4-[2-fluoro-4-[(E)-N-iodo-C-methylcarbonimidoyl]phenyl]piperazin-1-yl]-(5-methylsulfonyl-2-piperidin-1-ylphenyl)methanone (PubChem CID 143289185) has the molecular formula C25H30FIN4O3S and a molecular weight of 612.51 g/mol. Its IUPAC name is [4-[2-fluoro-4-[(E)-N-iodo-C-methylcarbonimidoyl]phenyl]piperazin-1-yl]-(5-methylsulfonyl-2-piperidin-1-ylphenyl)methanone.
| Compound Name | [4-[2-fluoro-4-[(E)-N-iodo-C-methylcarbonimidoyl]phenyl]piperazin-1-yl]-(5-methylsulfonyl-2-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 143289185 |
| Molecular Formula | C25H30FIN4O3S |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | [4-[2-fluoro-4-[(E)-N-iodo-C-methylcarbonimidoyl]phenyl]piperazin-1-yl]-(5-methylsulfonyl-2-piperidin-1-ylphenyl)methanone |
| SMILES | C/C(=N\I)c1ccc(N2CCN(C(=O)c3cc(S(C)(=O)=O)ccc3N3CCCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H30FIN4O3S/c1-18(28-27)19-6-8-24(22(26)16-19)30-12-14-31(15-13-30)25(32)21-17-20(35(2,33)34)7-9-23(21)29-10-4-3-5-11-29/h6-9,16-17H,3-5,10-15H2,1-2H3/b28-18+ |
| InChIKey | BERVUXMJCSZGSN-MTDXEUNCSA-N |
| XLogP | 4.34 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|