C19H17F4IN2O3S — CID 59793591
[4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-iodo-5-methylsulfonylphenyl)methanone (PubChem CID 59793591) has the molecular formula C19H17F4IN2O3S and a molecular weight of 556.32 g/mol. Its IUPAC name is [4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-iodo-5-methylsulfonylphenyl)methanone.
| Compound Name | [4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-iodo-5-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 59793591 |
| Molecular Formula | C19H17F4IN2O3S |
| Molecular Weight | 556.32 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | [4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-iodo-5-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1ccc(I)c(C(=O)N2CCN(c3ccc(C(F)(F)F)cc3F)CC2)c1 |
| InChI | InChI=1S/C19H17F4IN2O3S/c1-30(28,29)13-3-4-16(24)14(11-13)18(27)26-8-6-25(7-9-26)17-5-2-12(10-15(17)20)19(21,22)23/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | YFKNCDXBKHXWMI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|