C11H14N4O4 — CID 68559517
4-(5-nitro-2-pyridinyl)-1,4-diazepane-1-carboxylic acid (PubChem CID 68559517) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-(5-nitro-2-pyridinyl)-1,4-diazepane-1-carboxylic acid.
| Compound Name | 4-(5-nitro-2-pyridinyl)-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 68559517 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-(5-nitro-2-pyridinyl)-1,4-diazepane-1-carboxylic acid |
| SMILES | O=C(O)N1CCCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C11H14N4O4/c16-11(17)14-5-1-4-13(6-7-14)10-3-2-9(8-12-10)15(18)19/h2-3,8H,1,4-7H2,(H,16,17) |
| InChIKey | HPSRPRHMFCTEMV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|