C23H29N5O3 — CID 28526268
4-(5-nitro-2-pyridinyl)-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-1,4-diazepane-1-carboxamide (PubChem CID 28526268) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-(5-nitro-2-pyridinyl)-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(5-nitro-2-pyridinyl)-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 28526268 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 4-(5-nitro-2-pyridinyl)-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-1,4-diazepane-1-carboxamide |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)N2CCCN(c3ccc([N+](=O)[O-])cn3)CC2)c1 |
| InChI | InChI=1S/C23H29N5O3/c1-17(2)18-7-5-8-19(15-18)23(3,4)25-22(29)27-12-6-11-26(13-14-27)21-10-9-20(16-24-21)28(30)31/h5,7-10,15-16H,1,6,11-14H2,2-4H3,(H,25,29) |
| InChIKey | LPXQZJIFTYNXNA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|