C17H16F3N5O4 — CID 2795845
4-(5-nitro-2-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxamide (PubChem CID 2795845) has the molecular formula C17H16F3N5O4 and a molecular weight of 411.34 g/mol. Its IUPAC name is 4-(5-nitro-2-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(5-nitro-2-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2795845 |
| Molecular Formula | C17H16F3N5O4 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-(5-nitro-2-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C17H16F3N5O4/c18-17(19,20)29-14-4-1-12(2-5-14)22-16(26)24-9-7-23(8-10-24)15-6-3-13(11-21-15)25(27)28/h1-6,11H,7-10H2,(H,22,26) |
| InChIKey | DDAJXIYQONUBGN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|