About methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate
methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 10703555) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate.
Analyze methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate?
The IUPAC name of methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate (CID 10703555) is methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate.
What is the SMILES notation for methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate?
The canonical SMILES for methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate is COC(=O)[C@@H]1Cc2ccc(OC)cc2O1.
What is the InChIKey of methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate?
The InChIKey is BNUNWMBCLXKDEY-JTQLQIEISA-N. The full InChI is InChI=1S/C11H12O4/c1-13-8-4-3-7-5-10(11(12)14-2)15-9(7)6-8/h3-4,6,10H,5H2,1-2H3/t10-/m0/s1.
What are the key properties of methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate?
methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate has a molecular weight of 208.21 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylate is sourced from PubChem (CID 10703555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).