C15H20O — CID 175147590
2-methylspiro[2,3-dihydrochromene-4,1'-cyclohexane] (PubChem CID 175147590) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-methylspiro[2,3-dihydrochromene-4,1'-cyclohexane].
| Compound Name | 2-methylspiro[2,3-dihydrochromene-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 175147590 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-methylspiro[2,3-dihydrochromene-4,1'-cyclohexane] |
| SMILES | CC1CC2(CCCCC2)c2ccccc2O1 |
| InChI | InChI=1S/C15H20O/c1-12-11-15(9-5-2-6-10-15)13-7-3-4-8-14(13)16-12/h3-4,7-8,12H,2,5-6,9-11H2,1H3 |
| InChIKey | NUEDNSTZURMURR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |