About spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride
spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride (PubChem CID 170897096) has the molecular formula C14H20ClN
and a molecular weight of 237.77 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride.
Molecular Properties
| Compound Name | spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride |
| PubChem CID | 170897096 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride |
| SMILES | Cl.NC1CC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H19N.ClH/c15-13-10-14(8-4-1-5-9-14)12-7-3-2-6-11(12)13;/h2-3,6-7,13H,1,4-5,8-10,15H2;1H |
| InChIKey | OSFQOWYDSUHMGE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride?
The IUPAC name of spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride (CID 170897096) is spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride.
What is the SMILES notation for spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride?
The canonical SMILES for spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride is Cl.NC1CC2(CCCCC2)c2ccccc21.
What is the InChIKey of spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride?
The InChIKey is OSFQOWYDSUHMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N.ClH/c15-13-10-14(8-4-1-5-9-14)12-7-3-2-6-11(12)13;/h2-3,6-7,13H,1,4-5,8-10,15H2;1H.
What are the key properties of spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride?
spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride has a molecular weight of 237.77 g/mol, XLogP of 3.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindene-3,1'-cyclohexane]-1-amine;hydrochloride is sourced from PubChem (CID 170897096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).