C16H17NO2 — CID 107089666
3-amino-1-(4-methoxyphenyl)-2,3-dihydroinden-1-ol (PubChem CID 107089666) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-amino-1-(4-methoxyphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 3-amino-1-(4-methoxyphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 107089666 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-amino-1-(4-methoxyphenyl)-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc(C2(O)CC(N)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-19-12-8-6-11(7-9-12)16(18)10-15(17)13-4-2-3-5-14(13)16/h2-9,15,18H,10,17H2,1H3 |
| InChIKey | BLLNCUZFHJLBRY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |