C23H21NO3 — CID 174272459
1-(4-aminophenyl)-3-(4-methoxyphenyl)-2,3-dihydroindene-1-carboxylic acid (PubChem CID 174272459) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(4-methoxyphenyl)-2,3-dihydroindene-1-carboxylic acid.
| Compound Name | 1-(4-aminophenyl)-3-(4-methoxyphenyl)-2,3-dihydroindene-1-carboxylic acid |
|---|---|
| PubChem CID | 174272459 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(4-aminophenyl)-3-(4-methoxyphenyl)-2,3-dihydroindene-1-carboxylic acid |
| SMILES | COc1ccc(C2CC(C(=O)O)(c3ccc(N)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-27-18-12-6-15(7-13-18)20-14-23(22(25)26,16-8-10-17(24)11-9-16)21-5-3-2-4-19(20)21/h2-13,20H,14,24H2,1H3,(H,25,26) |
| InChIKey | WKDVORNNBWSCFN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|