C46H40O6 — CID 144703983
2-[6-[3-phenyl-1-[6-(2-prop-2-enoyloxyethoxy)naphthalen-2-yl]-2,3-dihydroinden-1-yl]naphthalen-2-yl]oxyethyl but-3-enoate (PubChem CID 144703983) has the molecular formula C46H40O6 and a molecular weight of 688.82 g/mol. Its IUPAC name is 2-[6-[3-phenyl-1-[6-(2-prop-2-enoyloxyethoxy)naphthalen-2-yl]-2,3-dihydroinden-1-yl]naphthalen-2-yl]oxyethyl but-3-enoate.
| Compound Name | 2-[6-[3-phenyl-1-[6-(2-prop-2-enoyloxyethoxy)naphthalen-2-yl]-2,3-dihydroinden-1-yl]naphthalen-2-yl]oxyethyl but-3-enoate |
|---|---|
| PubChem CID | 144703983 |
| Molecular Formula | C46H40O6 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | 2-[6-[3-phenyl-1-[6-(2-prop-2-enoyloxyethoxy)naphthalen-2-yl]-2,3-dihydroinden-1-yl]naphthalen-2-yl]oxyethyl but-3-enoate |
| SMILES | C=CCC(=O)OCCOc1ccc2cc(C3(c4ccc5cc(OCCOC(=O)C=C)ccc5c4)CC(c4ccccc4)c4ccccc43)ccc2c1 |
| InChI | InChI=1S/C46H40O6/c1-3-10-45(48)52-26-24-50-40-22-18-34-28-38(20-16-36(34)30-40)46(31-42(32-11-6-5-7-12-32)41-13-8-9-14-43(41)46)37-19-15-35-29-39(21-17-33(35)27-37)49-23-25-51-44(47)4-2/h3-9,11-22,27-30,42H,1-2,10,23-26,31H2 |
| InChIKey | KBTKXQFYTIBXCV-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|