C38H31NO6 — CID 165377878
2-[4-[11-[4-(2-prop-2-enoyloxyethoxy)phenyl]indeno[1,2-b]quinolin-11-yl]phenoxy]ethyl prop-2-enoate (PubChem CID 165377878) has the molecular formula C38H31NO6 and a molecular weight of 597.67 g/mol. Its IUPAC name is 2-[4-[11-[4-(2-prop-2-enoyloxyethoxy)phenyl]indeno[1,2-b]quinolin-11-yl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[11-[4-(2-prop-2-enoyloxyethoxy)phenyl]indeno[1,2-b]quinolin-11-yl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 165377878 |
| Molecular Formula | C38H31NO6 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 2-[4-[11-[4-(2-prop-2-enoyloxyethoxy)phenyl]indeno[1,2-b]quinolin-11-yl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C2(c3ccc(OCCOC(=O)C=C)cc3)c3ccccc3-c3nc4ccccc4cc32)cc1 |
| InChI | InChI=1S/C38H31NO6/c1-3-35(40)44-23-21-42-29-17-13-27(14-18-29)38(28-15-19-30(20-16-28)43-22-24-45-36(41)4-2)32-11-7-6-10-31(32)37-33(38)25-26-9-5-8-12-34(26)39-37/h3-20,25H,1-2,21-24H2 |
| InChIKey | FQRJJRMSKBESJG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|