About [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate
[(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate (PubChem CID 10765176) has the molecular formula C25H24N2O5
and a molecular weight of 432.48 g/mol. Its IUPAC name is [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate.
Molecular Properties
| Compound Name | [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate |
| PubChem CID | 10765176 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate |
| SMILES | COc1ccc([C@H]2C[C@](OC(=O)c3ccc(N)cc3)(C(C)=O)ON2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-17(28)25(31-24(29)19-8-12-20(26)13-9-19)16-23(18-10-14-22(30-2)15-11-18)27(32-25)21-6-4-3-5-7-21/h3-15,23H,16,26H2,1-2H3/t23-,25-/m1/s1 |
| InChIKey | WFQQLNLHSXNSAP-ILBGXUMGSA-N |
| XLogP | 4.30 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate?
The IUPAC name of [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate (CID 10765176) is [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate.
What is the SMILES notation for [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate?
The canonical SMILES for [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate is COc1ccc([C@H]2C[C@](OC(=O)c3ccc(N)cc3)(C(C)=O)ON2c2ccccc2)cc1.
What is the InChIKey of [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate?
The InChIKey is WFQQLNLHSXNSAP-ILBGXUMGSA-N. The full InChI is InChI=1S/C25H24N2O5/c1-17(28)25(31-24(29)19-8-12-20(26)13-9-19)16-23(18-10-14-22(30-2)15-11-18)27(32-25)21-6-4-3-5-7-21/h3-15,23H,16,26H2,1-2H3/t23-,25-/m1/s1.
What are the key properties of [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate?
[(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate has a molecular weight of 432.48 g/mol, XLogP of 4.30, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-5-acetyl-3-(4-methoxyphenyl)-2-phenyl-1,2-oxazolidin-5-yl] 4-aminobenzoate is sourced from PubChem (CID 10765176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).