C16H15F2NO — CID 107089749
3-amino-1-(2,6-difluoro-3-methylphenyl)-2,3-dihydroinden-1-ol (PubChem CID 107089749) has the molecular formula C16H15F2NO and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-amino-1-(2,6-difluoro-3-methylphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 3-amino-1-(2,6-difluoro-3-methylphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 107089749 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-amino-1-(2,6-difluoro-3-methylphenyl)-2,3-dihydroinden-1-ol |
| SMILES | Cc1ccc(F)c(C2(O)CC(N)c3ccccc32)c1F |
| InChI | InChI=1S/C16H15F2NO/c1-9-6-7-12(17)14(15(9)18)16(20)8-13(19)10-4-2-3-5-11(10)16/h2-7,13,20H,8,19H2,1H3 |
| InChIKey | XCTNGABHGTUARR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |