About 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol
8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol (PubChem CID 163321412) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol.
Analyze 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol?
The IUPAC name of 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol (CID 163321412) is 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol.
What is the SMILES notation for 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol?
The canonical SMILES for 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol is OCC12CC(C1)Oc1ccccc12.
What is the InChIKey of 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol?
The InChIKey is JVTBZWZKUDMXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-7-11-5-8(6-11)13-10-4-2-1-3-9(10)11/h1-4,8,12H,5-7H2.
What are the key properties of 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol?
8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol has a molecular weight of 176.22 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxatricyclo[7.1.1.02,7]undeca-2,4,6-trien-1-ylmethanol is sourced from PubChem (CID 163321412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).