C13H17NO2 — CID 131859580
(1S,2R)-spiro[1,2-dihydroindene-3,4'-piperidine]-1,2-diol (PubChem CID 131859580) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (1S,2R)-spiro[1,2-dihydroindene-3,4'-piperidine]-1,2-diol.
| Compound Name | (1S,2R)-spiro[1,2-dihydroindene-3,4'-piperidine]-1,2-diol |
|---|---|
| PubChem CID | 131859580 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (1S,2R)-spiro[1,2-dihydroindene-3,4'-piperidine]-1,2-diol |
| SMILES | O[C@H]1c2ccccc2C2(CCNCC2)[C@H]1O |
| InChI | InChI=1S/C13H17NO2/c15-11-9-3-1-2-4-10(9)13(12(11)16)5-7-14-8-6-13/h1-4,11-12,14-16H,5-8H2/t11-,12-/m0/s1 |
| InChIKey | UKJSYEIVCGFUES-RYUDHWBXSA-N |
| XLogP | 0.72 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |