C21H33N3O3 — CID 28954987
(1R,2R)-1-[4-(2,2-dimethoxyethyl)piperazin-1-yl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (PubChem CID 28954987) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is (1R,2R)-1-[4-(2,2-dimethoxyethyl)piperazin-1-yl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
| Compound Name | (1R,2R)-1-[4-(2,2-dimethoxyethyl)piperazin-1-yl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
|---|---|
| PubChem CID | 28954987 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | (1R,2R)-1-[4-(2,2-dimethoxyethyl)piperazin-1-yl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| SMILES | COC(CN1CCN([C@@H]2c3ccccc3C3(CCNCC3)[C@H]2O)CC1)OC |
| InChI | InChI=1S/C21H33N3O3/c1-26-18(27-2)15-23-11-13-24(14-12-23)19-16-5-3-4-6-17(16)21(20(19)25)7-9-22-10-8-21/h3-6,18-20,22,25H,7-15H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | NQIISIOUMNGZFB-UXHICEINSA-N |
| XLogP | 0.96 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|