About 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine
1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine (PubChem CID 81093537) has the molecular formula C11H23N3O2
and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine |
| PubChem CID | 81093537 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine |
| SMILES | COC(CN1CCN(C2CNC2)CC1)OC |
| InChI | InChI=1S/C11H23N3O2/c1-15-11(16-2)9-13-3-5-14(6-4-13)10-7-12-8-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | RYDMGYWFHRBDOY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine?
The IUPAC name of 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine (CID 81093537) is 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine.
What is the SMILES notation for 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine?
The canonical SMILES for 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine is COC(CN1CCN(C2CNC2)CC1)OC.
What is the InChIKey of 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine?
The InChIKey is RYDMGYWFHRBDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2/c1-15-11(16-2)9-13-3-5-14(6-4-13)10-7-12-8-10/h10-12H,3-9H2,1-2H3.
What are the key properties of 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine?
1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine has a molecular weight of 229.32 g/mol, XLogP of -0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-4-(2,2-dimethoxyethyl)piperazine is sourced from PubChem (CID 81093537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).