C12H25N3O2 — CID 112739446
1-[1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]piperazine (PubChem CID 112739446) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-[1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 112739446 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 1-[1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]piperazine |
| SMILES | COC(CN1CCC(N2CCNCC2)C1)OC |
| InChI | InChI=1S/C12H25N3O2/c1-16-12(17-2)10-14-6-3-11(9-14)15-7-4-13-5-8-15/h11-13H,3-10H2,1-2H3 |
| InChIKey | PPQVSPZMQZIMAT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|