C9H20N2O2 — CID 66222772
[1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]methanamine (PubChem CID 66222772) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is [1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 66222772 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | [1-(2,2-dimethoxyethyl)pyrrolidin-3-yl]methanamine |
| SMILES | COC(CN1CCC(CN)C1)OC |
| InChI | InChI=1S/C9H20N2O2/c1-12-9(13-2)7-11-4-3-8(5-10)6-11/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | PVSNQMBYSNOTMC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|