C10H19F3N2O2 — CID 66223203
1-(2,2-dimethoxyethyl)-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 66223203) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(2,2-dimethoxyethyl)-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 66223203 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | COC(CN1CCN(CC(F)(F)F)CC1)OC |
| InChI | InChI=1S/C10H19F3N2O2/c1-16-9(17-2)7-14-3-5-15(6-4-14)8-10(11,12)13/h9H,3-8H2,1-2H3 |
| InChIKey | WYKLEWAZECGDPW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|