C11H22N2O3 — CID 66221900
1-[4-(2,2-dimethoxyethyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 66221900) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[4-(2,2-dimethoxyethyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(2,2-dimethoxyethyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 66221900 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-[4-(2,2-dimethoxyethyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COC(CN1CCCN(C(C)=O)CC1)OC |
| InChI | InChI=1S/C11H22N2O3/c1-10(14)13-6-4-5-12(7-8-13)9-11(15-2)16-3/h11H,4-9H2,1-3H3 |
| InChIKey | QCZCCOBRNFCGHY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|