C10H19BrN2O2 — CID 112561492
1-[4-(3-bromo-2-hydroxypropyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 112561492) has the molecular formula C10H19BrN2O2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 1-[4-(3-bromo-2-hydroxypropyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(3-bromo-2-hydroxypropyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 112561492 |
| Molecular Formula | C10H19BrN2O2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-[4-(3-bromo-2-hydroxypropyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(CC(O)CBr)CC1 |
| InChI | InChI=1S/C10H19BrN2O2/c1-9(14)13-4-2-3-12(5-6-13)8-10(15)7-11/h10,15H,2-8H2,1H3 |
| InChIKey | WUEYXYJGGMCUHO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|