C16H29BrN2O — CID 65009984
1-[4-[[1-(bromomethyl)cycloheptyl]methyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 65009984) has the molecular formula C16H29BrN2O and a molecular weight of 345.33 g/mol. Its IUPAC name is 1-[4-[[1-(bromomethyl)cycloheptyl]methyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[[1-(bromomethyl)cycloheptyl]methyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 65009984 |
| Molecular Formula | C16H29BrN2O |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[4-[[1-(bromomethyl)cycloheptyl]methyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(CC2(CBr)CCCCCC2)CC1 |
| InChI | InChI=1S/C16H29BrN2O/c1-15(20)19-10-6-9-18(11-12-19)14-16(13-17)7-4-2-3-5-8-16/h2-14H2,1H3 |
| InChIKey | LSDLSGCJBFNVDR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|