C15H23N3O2 — CID 62266489
1-[4-[2-(2-aminophenyl)-2-hydroxyethyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 62266489) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[4-[2-(2-aminophenyl)-2-hydroxyethyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[2-(2-aminophenyl)-2-hydroxyethyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 62266489 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-[4-[2-(2-aminophenyl)-2-hydroxyethyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(CC(O)c2ccccc2N)CC1 |
| InChI | InChI=1S/C15H23N3O2/c1-12(19)18-8-4-7-17(9-10-18)11-15(20)13-5-2-3-6-14(13)16/h2-3,5-6,15,20H,4,7-11,16H2,1H3 |
| InChIKey | HACDRGZLYMFJMX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|