C9H16F3N3 — CID 62967528
1-(azetidin-3-yl)-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 62967528) has the molecular formula C9H16F3N3 and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(azetidin-3-yl)-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 62967528 |
| Molecular Formula | C9H16F3N3 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | FC(F)(F)CN1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C9H16F3N3/c10-9(11,12)7-14-1-3-15(4-2-14)8-5-13-6-8/h8,13H,1-7H2 |
| InChIKey | AYFVKJDNOCTVRA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |