C13H26N2O2 — CID 63619023
1-cyclopropyl-4-(2,2-diethoxyethyl)piperazine (PubChem CID 63619023) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-cyclopropyl-4-(2,2-diethoxyethyl)piperazine.
| Compound Name | 1-cyclopropyl-4-(2,2-diethoxyethyl)piperazine |
|---|---|
| PubChem CID | 63619023 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-cyclopropyl-4-(2,2-diethoxyethyl)piperazine |
| SMILES | CCOC(CN1CCN(C2CC2)CC1)OCC |
| InChI | InChI=1S/C13H26N2O2/c1-3-16-13(17-4-2)11-14-7-9-15(10-8-14)12-5-6-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | FIXGRZLNAIKDBT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|