C13H26N2O3 — CID 55249753
2-[1-(2,2-diethoxyethyl)piperidin-4-yl]acetamide (PubChem CID 55249753) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[1-(2,2-diethoxyethyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[1-(2,2-diethoxyethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 55249753 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2-[1-(2,2-diethoxyethyl)piperidin-4-yl]acetamide |
| SMILES | CCOC(CN1CCC(CC(N)=O)CC1)OCC |
| InChI | InChI=1S/C13H26N2O3/c1-3-17-13(18-4-2)10-15-7-5-11(6-8-15)9-12(14)16/h11,13H,3-10H2,1-2H3,(H2,14,16) |
| InChIKey | DZHGFNZMKCXQFA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|