C14H29NO2 — CID 63617165
1-(2,2-diethoxyethyl)-4-propylpiperidine (PubChem CID 63617165) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4-propylpiperidine.
| Compound Name | 1-(2,2-diethoxyethyl)-4-propylpiperidine |
|---|---|
| PubChem CID | 63617165 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4-propylpiperidine |
| SMILES | CCCC1CCN(CC(OCC)OCC)CC1 |
| InChI | InChI=1S/C14H29NO2/c1-4-7-13-8-10-15(11-9-13)12-14(16-5-2)17-6-3/h13-14H,4-12H2,1-3H3 |
| InChIKey | CXHQOJHJPFMPLZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|