C14H30N2O2 — CID 55248399
1-(2,2-diethoxyethyl)-4-(2-methylpropyl)piperazine (PubChem CID 55248399) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4-(2-methylpropyl)piperazine.
| Compound Name | 1-(2,2-diethoxyethyl)-4-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 55248399 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4-(2-methylpropyl)piperazine |
| SMILES | CCOC(CN1CCN(CC(C)C)CC1)OCC |
| InChI | InChI=1S/C14H30N2O2/c1-5-17-14(18-6-2)12-16-9-7-15(8-10-16)11-13(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | VGXYXWMGVFQJCR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|